CymitQuimica logo

CAS 885950-25-4

:

1-[1-[(4-Bromophenyl)methyl]-5-methyl-1H-1,2,3-triazol-4-yl]ethanone

Description:
1-[1-[(4-Bromophenyl)methyl]-5-methyl-1H-1,2,3-triazol-4-yl]ethanone, with the CAS number 885950-25-4, is a chemical compound characterized by its unique triazole structure, which is a five-membered ring containing three nitrogen atoms. This compound features a bromophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the ethanone functional group indicates that it has ketone characteristics, which may influence its reactivity and interactions in various chemical environments. The methyl substitution on the triazole ring can affect the compound's steric and electronic properties, potentially enhancing its pharmacological profile. This compound may exhibit interesting properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the solvent and conditions, which are crucial for applications in drug development and synthesis. Overall, this compound represents a class of triazole derivatives that are significant in various chemical and pharmaceutical research fields.
Formula:C12H12BrN3O
InChI:InChI=1S/C12H12BrN3O/c1-8-12(9(2)17)14-15-16(8)7-10-3-5-11(13)6-4-10/h3-6H,7H2,1-2H3
InChI key:InChIKey=GQAPHZQIEJZSOW-UHFFFAOYSA-N
SMILES:C(N1C(C)=C(C(C)=O)N=N1)C2=CC=C(Br)C=C2
Synonyms:
  • Ethanone, 1-[1-[(4-bromophenyl)methyl]-5-methyl-1H-1,2,3-triazol-4-yl]-
  • 1-[1-[(4-Bromophenyl)methyl]-5-methyl-1H-1,2,3-triazol-4-yl]ethanone
Found 1 products.