CymitQuimica logo

CAS 885950-48-1

:

Ethyl 2′-formyl[1,1′-biphenyl]-4-carboxylate

Description:
Ethyl 2′-formyl[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a formyl group (-CHO) and a carboxylate group (-COOEt) attached to the biphenyl framework, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The compound may exhibit properties such as moderate polarity and potential for hydrogen bonding due to the functional groups present. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's unique arrangement of functional groups may influence its reactivity, making it a candidate for further studies in chemical reactivity and material science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H14O3
InChI:InChI=1S/C16H14O3/c1-2-19-16(18)13-9-7-12(8-10-13)15-6-4-3-5-14(15)11-17/h3-11H,2H2,1H3
InChI key:InChIKey=GEWDTBPSTDXEPT-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=CC=C1)C2=CC=C(C(OCC)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-carboxylic acid, 2′-formyl-, ethyl ester
  • Ethyl 2′-formyl[1,1′-biphenyl]-4-carboxylate
Found 1 products.