CymitQuimica logo

CAS 885950-58-3

:

2,3,4,5,6-Pentafluorophenyl 4-fluorobenzenesulfonate

Description:
2,3,4,5,6-Pentafluorophenyl 4-fluorobenzenesulfonate is a chemical compound characterized by its complex structure, which includes a pentafluorophenyl group and a 4-fluorobenzenesulfonate moiety. This compound is notable for its high fluorine content, which imparts unique properties such as increased stability and lipophilicity. It is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a versatile electrophile in nucleophilic substitution reactions. The presence of multiple fluorine atoms enhances its reactivity and can influence the electronic properties of the molecule, making it a valuable intermediate in various chemical transformations. Additionally, the sulfonate group contributes to its solubility in polar solvents, facilitating its use in diverse chemical environments. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,3,4,5,6-Pentafluorophenyl 4-fluorobenzenesulfonate is a significant compound in modern synthetic chemistry.
Formula:C12H4F6O3S
InChI:InChI=1S/C12H4F6O3S/c13-5-1-3-6(4-2-5)22(19,20)21-12-10(17)8(15)7(14)9(16)11(12)18/h1-4H
InChI key:InChIKey=ZRGXRWOGAFUFPE-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=CC=C(F)C=C1)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:
  • Benzenesulfonic acid, 4-fluoro-, pentafluorophenyl ester
  • Benzenesulfonic acid, 4-fluoro-, 2,3,4,5,6-pentafluorophenyl ester
  • Pentafluorophenyl 4-fluorophenylsulfonate
  • 2,3,4,5,6-Pentafluorophenyl 4-fluorobenzenesulfonate
Found 1 products.