CymitQuimica logo

CAS 885950-62-9

:

2,3,4,5,6-Pentafluorophenyl 2,4,6-trimethylbenzenesulfonate

Description:
2,3,4,5,6-Pentafluorophenyl 2,4,6-trimethylbenzenesulfonate is a chemical compound characterized by its complex structure, which includes a pentafluorophenyl group and a sulfonate moiety attached to a trimethyl-substituted benzene ring. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to act as a sulfonate leaving group in nucleophilic substitution reactions. The presence of multiple fluorine atoms enhances its electrophilic properties, making it a valuable intermediate in various chemical transformations. Additionally, the trimethyl groups contribute to steric hindrance, influencing the compound's reactivity and solubility in different solvents. Its unique characteristics, including high thermal stability and potential for selective reactivity, make it an interesting subject of study in both academic and industrial chemistry. Safety data should be consulted, as compounds with fluorinated groups can exhibit specific hazards.
Formula:C15H11F5O3S
InChI:InChI=1S/C15H11F5O3S/c1-6-4-7(2)15(8(3)5-6)24(21,22)23-14-12(19)10(17)9(16)11(18)13(14)20/h4-5H,1-3H3
InChI key:InChIKey=WHMSVBXYAVAYQY-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=C(C)C=C(C)C=C1C)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:
  • 2,3,4,5,6-Pentafluorophenyl 2,4,6-trimethylbenzenesulfonate
  • Benzenesulfonic acid, 2,4,6-trimethyl-, 2,3,4,5,6-pentafluorophenyl ester
Found 1 products.