CymitQuimica logo

CAS 885951-89-3

:

1,3-Pyrrolidinedicarboxylicacid, 1-(9H-fluoren-9-ylmethyl) ester

Description:
1,3-Pyrrolidinedicarboxylic acid, 1-(9H-fluoren-9-ylmethyl) ester, identified by CAS number 885951-89-3, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features two carboxylic acid groups attached to the pyrrolidine ring, contributing to its potential acidity and reactivity. The presence of the 9H-fluoren-9-ylmethyl ester moiety enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and drug design. The ester functionality can also participate in various chemical reactions, such as hydrolysis or transesterification. This compound may exhibit properties typical of both pyrrolidine derivatives and aromatic compounds, including potential applications in organic synthesis, pharmaceuticals, and materials science. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a versatile structure with potential implications in various chemical and biological contexts.
Formula:C20H19NO4
InChI:InChI=1S/C20H19NO4/c22-19(23)13-9-10-21(11-13)20(24)25-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12H2,(H,22,23)
InChI key:GUAMYYOQAAUXLR-UHFFFAOYSA-N
SMILES:C1CN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Synonyms:
  • Fmoc-1-Pyrrolidine-3-Carboxylic Acid
  • 3-Carboxy-1-Fmoc-Pyrrolidine
  • 1-N-Fmoc-Pyrrolidine-3-Carboxylic Acid
Found 5 products.