CymitQuimica logo

CAS 885952-16-9

:

2,3-Dibromo-6-chloropyridine

Description:
2,3-Dibromo-6-chloropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two bromine atoms and one chlorine atom. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and reactivity. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as color and melting point, which can vary based on purity and specific conditions. Its halogen substituents can influence its chemical reactivity, making it a potential candidate for various synthetic applications, including in the development of pharmaceuticals and agrochemicals. Additionally, the presence of multiple halogens can enhance its biological activity and lipophilicity. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,3-Dibromo-6-chloropyridine is of interest in organic synthesis and medicinal chemistry due to its unique structural features and potential applications.
Formula:C5H2Br2ClN
InChI:InChI=1/C5H2Br2ClN/c6-3-1-2-4(8)9-5(3)7/h1-2H
InChI key:YAEPXEMYHIOVFX-UHFFFAOYSA-N
SMILES:c1cc(Cl)nc(c1Br)Br
Synonyms:
  • Pyridine, 2,3-Dibromo-6-Chloro-
  • 2,3-Dibromo-6-chloropyridine
Found 4 products.