CymitQuimica logo

CAS 885953-19-5

:

3-Bromocyclopentanecarboxylic acid

Description:
3-Bromocyclopentanecarboxylic acid is an organic compound characterized by the presence of a bromine atom and a carboxylic acid functional group attached to a cyclopentane ring. The molecular structure features a five-membered carbon ring with a carboxylic acid (-COOH) group at one position and a bromine atom at the third carbon of the ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical synthesis processes, including the formation of more complex molecules through substitution reactions. Additionally, the carboxylic acid group contributes to its acidity and potential for forming salts and esters. As with many brominated compounds, it may exhibit specific biological activities, which can be of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this compound due to its potential reactivity and toxicity.
Formula:C6H9BrO2
InChI:InChI=1S/C6H9BrO2/c7-5-2-1-4(3-5)6(8)9/h4-5H,1-3H2,(H,8,9)
InChI key:InChIKey=LATBCFLVKUVJLV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC(Br)CC1
Synonyms:
  • 3-Bromocyclopentanecarboxylic acid
  • 3-Bromocyclopentane-1-carboxylic acid
  • Cyclopentanecarboxylic acid, 3-bromo-
Found 4 products.