CymitQuimica logo

CAS 885954-09-6

:

tert-butyl 2-aminopiperidine-1-carboxylate

Description:
Tert-butyl 2-aminopiperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a tert-butyl group, which enhances its lipophilicity and steric bulk, making it relevant in medicinal chemistry for drug design. The presence of an amino group at the 2-position of the piperidine ring contributes to its potential as a building block in the synthesis of various pharmaceuticals. The carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification or amidation, making it versatile in organic synthesis. Additionally, the compound's properties, such as solubility and stability, can be influenced by the tert-butyl group and the overall molecular structure. Its CAS number, 885954-09-6, allows for precise identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, tert-butyl 2-aminopiperidine-1-carboxylate is significant in the field of organic chemistry and drug development.
Formula:C10H20N2O2
InChI:InChI=1/C10H20N2O2/c1-10(2,3)14-9(13)12-7-5-4-6-8(12)11/h8H,4-7,11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCCCC1N
Synonyms:
  • 1-Piperidinecarboxylic Acid, 2-Amino-, 1,1-Dimethylethyl Ester
  • 2-Methyl-2-propanyl 2-amino-1-piperidinecarboxylate
  • tert-Butyl-2-aminopiperidin-1-carboxylat
Found 1 products.