CymitQuimica logo

CAS 88596-48-9

:

3-Pentyn-2-ol, 5,5-diethoxy-2-methyl-, acetate

Description:
3-Pentyn-2-ol, 5,5-diethoxy-2-methyl-, acetate, with the CAS number 88596-48-9, is an organic compound characterized by its unique structure that includes a triple bond, alcohol, and acetate functional groups. This compound features a pentynol backbone, indicating the presence of a triple bond between the second and third carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The presence of diethoxy groups enhances its solubility in organic solvents and may influence its physical properties, such as boiling and melting points. As an acetate, it is likely to exhibit moderate volatility and can participate in various chemical reactions, including esterification and nucleophilic substitutions. The compound's molecular structure suggests it may have applications in the synthesis of more complex organic molecules or as an intermediate in chemical processes. Safety data should be consulted for handling and storage, as compounds with similar structures can exhibit varying degrees of toxicity and reactivity.
Formula:C12H20O4
InChI:InChI=1S/C10H18O3.C2H4O2/c1-5-12-9(13-6-2)7-8-10(3,4)11;1-2(3)4/h9,11H,5-6H2,1-4H3;1H3,(H,3,4)
InChI key:ZHBIGQXGAZXKFJ-UHFFFAOYSA-N
SMILES:CCOC(C#CC(C)(C)O)OCC.CC(=O)O
Found 1 products.