CAS 88596-63-8
:1H-1,2,3-Triazole, 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-
Description:
1H-1,2,3-Triazole, 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl- is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an azido group, which is known for its reactivity and potential applications in click chemistry, making it valuable in synthetic organic chemistry and materials science. The presence of the phenyl groups contributes to its aromatic character, potentially influencing its solubility and stability. The compound's structure suggests it may exhibit interesting biological activities, although specific biological properties would require empirical investigation. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Safety considerations are essential when handling this compound, particularly due to the azido group, which can be explosive under certain conditions. Overall, this compound exemplifies the complexity and utility of triazole derivatives in chemical research and applications.
Formula:C19H20N6
InChI:InChI=1S/C19H20N6/c1-18(2,3)19(23-24-20,15-12-8-5-9-13-15)17-16(21-25-22-17)14-10-6-4-7-11-14/h4-13H,1-3H3,(H,21,22,25)
InChI key:XMQRVHHPBQYMRN-UHFFFAOYSA-N
SMILES:CC(C)(C)C(C1=CC=CC=C1)(C2=NNN=C2C3=CC=CC=C3)N=[N+]=[N-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1H-1,2,3-Triazole, 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-
CAS:Formula:C19H20N6Molecular weight:332.4023
