CAS 88596-72-9
:3H-Pyrrol-3-one, 5-(diethylamino)-2-(1,1-dimethylethyl)-4-methyl-
Description:
3H-Pyrrol-3-one, 5-(diethylamino)-2-(1,1-dimethylethyl)-4-methyl- is an organic compound characterized by its pyrrolone structure, which features a five-membered ring containing both nitrogen and a carbonyl group. This compound is notable for its diethylamino substituent, which contributes to its basicity and potential biological activity. The presence of the tert-butyl group (1,1-dimethylethyl) and the methyl group enhances its steric bulk, influencing its reactivity and solubility properties. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its interactions with biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of nitrogen-containing groups that may pose specific health risks.
Formula:C13H22N2O
InChI:InChI=1S/C13H22N2O/c1-7-15(8-2)12-9(3)10(16)11(14-12)13(4,5)6/h7-8H2,1-6H3
InChI key:OIPQDSIJKWBSJB-UHFFFAOYSA-N
SMILES:CCN(CC)C1=C(C(=O)C(=N1)C(C)(C)C)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3H-Pyrrol-3-one, 5-(diethylamino)-2-(1,1-dimethylethyl)-4-methyl-
CAS:Formula:C13H22N2OMolecular weight:222.3266
