CymitQuimica logo

CAS 88596-74-1

:

2,4-Pyridinediamine, N,N,N',N'-tetraethyl-3,5,6-trimethyl-

Description:
2,4-Pyridinediamine, N,N,N',N'-tetraethyl-3,5,6-trimethyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features multiple ethyl groups and methyl substituents, contributing to its complex structure and potentially influencing its solubility and reactivity. It is typically used in various chemical applications, including as a reagent in organic synthesis or as an intermediate in the production of dyes and pharmaceuticals. The presence of amine functional groups suggests that it may exhibit basic properties and can participate in hydrogen bonding, which can affect its interactions with other molecules. Additionally, the specific arrangement of substituents on the pyridine ring can influence the compound's electronic properties and steric hindrance, impacting its biological activity and potential applications. Safety data should be consulted for handling and usage, as compounds with amine groups can sometimes be hazardous.
Formula:C16H29N3
InChI:InChI=1S/C16H29N3/c1-8-18(9-2)15-12(5)14(7)17-16(13(15)6)19(10-3)11-4/h8-11H2,1-7H3
InChI key:KUPJFQMFSLDVNK-UHFFFAOYSA-N
SMILES:CCN(CC)C1=C(C(=NC(=C1C)C)N(CC)CC)C
Found 1 products.