CymitQuimica logo

CAS 88596-83-2

:

Naphthalene, 2-azido-3-isocyanato-

Description:
Naphthalene, 2-azido-3-isocyanato- (CAS 88596-83-2) is a chemical compound characterized by the presence of both an azido group (-N3) and an isocyanate group (-N=C=O) attached to a naphthalene ring. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the naphthalene structure, which consists of two fused benzene rings. The azido group is known for its potential reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. The isocyanate group contributes to the compound's reactivity, making it useful in the synthesis of polyurethanes and other polymers. Additionally, naphthalene derivatives often display interesting optical and electronic properties, which can be exploited in materials science and organic electronics. However, handling such compounds requires caution due to their potential toxicity and reactivity, particularly the azido and isocyanate functionalities, which can pose safety hazards.
Formula:C11H6N4O
InChI:InChI=1S/C11H6N4O/c12-15-14-11-6-9-4-2-1-3-8(9)5-10(11)13-7-16/h1-6H
InChI key:HTYLMMSETSHWOD-UHFFFAOYSA-N
SMILES:C1=CC=C2C=C(C(=CC2=C1)N=C=O)N=[N+]=[N-]
Found 1 products.