CymitQuimica logo

CAS 885962-24-3

:

2-(3-bromophenyl)piperazine

Description:
2-(3-Bromophenyl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a bromophenyl group at the second position of the piperazine ring introduces significant steric and electronic effects, influencing its chemical reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the piperazine moiety, while the bromine substituent can enhance lipophilicity and affect its interaction with biological targets. It is often studied in medicinal chemistry for its potential pharmacological applications, particularly in the development of psychoactive drugs and as a scaffold for various therapeutic agents. The compound's structure allows for various substitution patterns, which can be explored to optimize its efficacy and selectivity in biological systems. Safety and handling considerations are essential, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C10H13BrN2
InChI:InChI=1/C10H13BrN2/c11-9-3-1-2-8(6-9)10-7-12-4-5-13-10/h1-3,6,10,12-13H,4-5,7H2
SMILES:c1cc(cc(c1)Br)C1CNCCN1
Synonyms:
  • 2-(3-Bromphenyl)piperazin
  • Piperazine, 2-(3-bromophenyl)-
  • 2-(3-Bromophenyl)piperazine
  • 2-(3-BROMO-PHENYL)-PIPERAZINE
Found 1 products.