CAS 885963-22-4
:[1,1'-Biphenyl]-3-carboxaldehyde,3'-chloro-4'-methyl-
Description:
[1,1'-Biphenyl]-3-carboxaldehyde, 3'-chloro-4'-methyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxaldehyde functional group (-CHO) at the 3-position of one phenyl ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. The chloro group at the 3'-position and the methyl group at the 4'-position on the adjacent phenyl ring introduce additional functional diversity, influencing the compound's physical and chemical properties, such as solubility and reactivity. This compound may exhibit interesting biological activities and could be utilized in synthetic organic chemistry as an intermediate or building block for more complex molecules. Its specific characteristics, including melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C14H11ClO
InChI:InChI=1S/C14H11ClO/c1-10-5-6-13(8-14(10)15)12-4-2-3-11(7-12)9-16/h2-9H,1H3
InChI key:IONVCUOGOLYMQU-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)C2=CC=CC(=C2)C=O)Cl
Synonyms:- 3-(4-Chloro-2-methylphenyl)benzaldehyde
- 3-(5-Chloro-2-methylphenyl)benzaldehyde
- 3-(3-Chloro-5-methylphenyl)benzaldehyde
- 3-(3-Chloro-4-methylphenyl)benzaldehyde
- 3'-Chloro-4'-methyl[1,1'-biphenyl]-3-carboxaldehyde
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
