CymitQuimica logo

CAS 885963-56-4

:

[1,1'-Biphenyl]-3-methanol,3',5'-difluoro-

Description:
[1,1'-Biphenyl]-3-methanol,3',5'-difluoro- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methanol group at the 3-position of one phenyl ring introduces a hydroxyl (-OH) functional group, enhancing its solubility in polar solvents. Additionally, the difluoro substituents at the 3' and 5' positions of the other phenyl ring contribute to its unique electronic properties and potential reactivity. These fluorine atoms can influence the compound's polarity, stability, and interaction with biological systems. The compound may exhibit interesting properties such as altered melting and boiling points compared to its non-fluorinated counterparts, as well as potential applications in pharmaceuticals, agrochemicals, or materials science due to its structural characteristics. As with many organic compounds, its behavior in various chemical reactions and its environmental impact would depend on the specific conditions and the presence of other substances.
Formula:C13H10F2O
InChI:InChI=1S/C13H10F2O/c14-12-5-11(6-13(15)7-12)10-3-1-2-9(4-10)8-16/h1-7,16H,8H2
InChI key:WWQBEFYGHVYWIY-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)C2=CC(=CC(=C2)F)F)CO
Synonyms:
  • 3-(3,5-Difluorophenyl)benzyl alcohol
Found 1 products.