CymitQuimica logo

CAS 885964-56-7

:

[1,1'-Biphenyl]-3-carboxylicacid, 3'-fluoro-4'-methyl-

Description:
[1,1'-Biphenyl]-3-carboxylic acid, 3'-fluoro-4'-methyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group (-COOH) at the 3-position of one phenyl ring contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The substitution of a fluorine atom at the 3'-position and a methyl group at the 4'-position of the other phenyl ring introduces unique electronic and steric effects, which can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity. This compound may exhibit interesting biological activities, making it relevant in pharmaceutical research. Additionally, its structural features suggest potential applications in materials science and organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to the potential hazards associated with its chemical properties.
Formula:C14H11FO2
InChI:InChI=1S/C14H11FO2/c1-9-5-6-11(8-13(9)15)10-3-2-4-12(7-10)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:VEWZKMNALHTVOT-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)C2=CC(=CC=C2)C(=O)O)F
Synonyms:
  • 3-(3-Fluoro-4-methylphenyl)benzoic acid
  • 3-(3-Fluoro-5-methylphenyl)benzoic acid
  • 3-(5-Fluoro-2-methylphenyl)benzoic acid
Found 1 products.