CAS 885965-71-9
:Benzeneethanimidamide,2,6-difluoro-
Description:
Benzeneethanimidamide, 2,6-difluoro- is a chemical compound characterized by its structure, which includes a benzene ring substituted with an ethanimidamide group and two fluorine atoms at the 2 and 6 positions of the aromatic ring. This compound is likely to exhibit properties typical of both aromatic amines and fluorinated compounds, such as increased lipophilicity and potential biological activity due to the presence of the fluorine atoms, which can influence the compound's reactivity and interaction with biological targets. The presence of the ethanimidamide functional group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the fluorine substituents may enhance the compound's stability and metabolic profile. As with many fluorinated compounds, it may also exhibit unique physical and chemical properties, such as altered boiling and melting points compared to its non-fluorinated counterparts. Safety and handling considerations should be taken into account, as with any chemical substance, particularly those with potential biological activity.
Formula:C8H8F2N2
InChI:InChI=1S/C8H8F2N2/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3H,4H2,(H3,11,12)
InChI key:BYLJRRVZMJRGRK-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)F)CC(=N)N)F
Synonyms:- 2-(2,6-Difluoro-Phenyl)-Acetamidine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
