CymitQuimica logo

CAS 885965-83-3

:

Benzeneethanimidamide,2,5-difluoro-

Description:
Benzeneethanimidamide, 2,5-difluoro- is an organic compound characterized by its structure, which includes a benzene ring and an ethanimidamide functional group, along with two fluorine substituents at the 2 and 5 positions of the benzene ring. This compound is likely to exhibit properties typical of aromatic amides, such as stability due to resonance and potential hydrogen bonding capabilities. The presence of fluorine atoms can influence its reactivity, solubility, and biological activity, often enhancing lipophilicity and altering electronic properties. As a result, compounds like this may be of interest in medicinal chemistry and material science. The specific interactions and applications would depend on its precise molecular structure and the context in which it is used, such as in drug development or as a chemical intermediate. Safety and handling considerations would also be important, given the potential toxicity associated with fluorinated compounds. Overall, Benzeneethanimidamide, 2,5-difluoro- represents a unique chemical entity with potential applications in various fields of research.
Formula:C8H8F2N2
InChI:InChI=1S/C8H8F2N2/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3H,4H2,(H3,11,12)
InChI key:DIPNLCCOSPWYMG-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1F)CC(=N)N)F
Synonyms:
  • 2-(2,5-Difluoro-Phenyl)-Acetamidine
Found 1 products.