CymitQuimica logo

CAS 885966-08-5

:

[1,1'-Biphenyl]-3-methanol,2'-(trifluoromethyl)-

Description:
[1,1'-Biphenyl]-3-methanol,2'-(trifluoromethyl)- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxymethyl group (-CH2OH) at the 3-position of one phenyl ring and a trifluoromethyl group (-CF3) at the 2'-position of the other phenyl ring significantly influences its chemical properties. This compound is likely to exhibit unique reactivity due to the electron-withdrawing nature of the trifluoromethyl group, which can enhance its acidity and alter its electronic characteristics. Additionally, the hydroxymethyl group can participate in hydrogen bonding, affecting solubility and interaction with other molecules. The compound may be of interest in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its potential biological activity and unique physical properties. As with many organic compounds, its stability, reactivity, and interactions will depend on environmental conditions such as temperature and solvent polarity.
Formula:C14H11F3O
InChI:InChI=1S/C14H11F3O/c15-14(16,17)13-7-2-1-6-12(13)11-5-3-4-10(8-11)9-18/h1-8,18H,9H2
InChI key:KNOZWVVKUYTQCA-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C2=CC=CC(=C2)CO)C(F)(F)F
Synonyms:
  • 3-(2-(Trifluoromethyl)phenyl)benzyl alcohol
Found 1 products.