CymitQuimica logo

CAS 88597-06-2

:

1H-Isoindole-1,3(2H)-dione, 2-[3-[[(4-methylphenyl)sulfonyl]oxy]propyl]-

Description:
1H-Isoindole-1,3(2H)-dione, 2-[3-[[(4-methylphenyl)sulfonyl]oxy]propyl]- is a chemical compound characterized by its isoindole structure, which features a bicyclic system consisting of a five-membered ring fused to a six-membered ring. The presence of a sulfonyl group attached to a propyl chain indicates that this compound may exhibit significant polarity and potential for hydrogen bonding, influencing its solubility and reactivity. The 4-methylphenyl group contributes to the compound's hydrophobic characteristics, which may affect its interaction with biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific biological activities. Additionally, the presence of the dione functional groups suggests potential reactivity in various chemical transformations. Overall, the unique combination of functional groups and structural elements in this compound may lead to diverse applications in pharmaceuticals or materials science, warranting further investigation into its properties and potential uses.
Formula:C18H17NO5S
InChI:InChI=1S/C18H17NO5S/c1-13-7-9-14(10-8-13)25(22,23)24-12-4-11-19-17(20)15-5-2-3-6-16(15)18(19)21/h2-3,5-10H,4,11-12H2,1H3
InChI key:HXCZYABFGDIBGE-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)OCCCN2C(=O)C3=CC=CC=C3C2=O
Synonyms:
  • 3-(Tosyloxy)propyl phthaliMide
  • 1H-Isoindole-1,3(2H)-dione, 2-[3-[[(4-methylphenyl)sulfonyl]oxy]propyl]-
Found 1 products.