CymitQuimica logo

CAS 88598-21-4

:

Piperidine, 1-(2-propynyl)-, ethanedioate

Description:
Piperidine, 1-(2-propynyl)-, ethanedioate, with the CAS number 88598-21-4, is a chemical compound that features a piperidine ring substituted with a propynyl group and is associated with ethanedioic acid (oxalic acid) as a diacid salt. This compound typically exhibits characteristics common to piperidine derivatives, such as being a colorless to pale yellow liquid or solid, depending on its form. It is likely to be soluble in polar organic solvents due to the presence of the piperidine nitrogen, which can engage in hydrogen bonding. The propynyl group introduces alkyne characteristics, potentially affecting its reactivity and interactions. The ethanedioate component suggests that the compound may form salts or complexes, influencing its stability and solubility in various environments. As with many piperidine derivatives, it may exhibit biological activity, making it of interest in medicinal chemistry. However, specific safety and handling information should be consulted, as the toxicity and reactivity can vary based on the compound's structure and functional groups.
Formula:C8H13NxC2H2O4
InChI:InChI=1S/C8H13N.C2H2O4/c1-2-6-9-7-4-3-5-8-9;3-1(4)2(5)6/h1H,3-8H2;(H,3,4)(H,5,6)
InChI key:VJSMXZYRRBDQRB-UHFFFAOYSA-N
SMILES:C#CCN1CCCCC1.C(=O)(C(=O)O)O
Found 1 products.