CAS 88598-78-1
:Propanedioic acid, (2-[1,1'-biphenyl]-4-yl-2-oxoethyl)methyl-
Description:
Propanedioic acid, (2-[1,1'-biphenyl]-4-yl-2-oxoethyl)methyl- is a chemical compound characterized by its structure, which includes a propanedioic acid backbone and a substituted biphenyl moiety. The presence of the biphenyl group suggests potential applications in organic electronics or as a building block in organic synthesis due to its aromatic properties. The compound features functional groups that may exhibit acidic behavior, typical of carboxylic acids, and the presence of a ketone functionality (2-oxo) indicates potential reactivity in various chemical transformations. Its molecular structure likely contributes to its solubility and interaction with other substances, making it of interest in fields such as medicinal chemistry, materials science, or agrochemicals. The CAS number 88598-78-1 uniquely identifies this compound, facilitating its recognition in chemical databases and literature. Overall, the compound's characteristics suggest it may have diverse applications depending on its reactivity and the specific properties imparted by its functional groups.
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c1-18(16(20)21,17(22)23)11-15(19)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,20,21)(H,22,23)
InChI key:LRZSUVXLJFBPNB-UHFFFAOYSA-N
SMILES:CC(CC(=O)C1=CC=C(C=C1)C2=CC=CC=C2)(C(=O)O)C(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Propanedioic acid, (2-[1,1'-biphenyl]-4-yl-2-oxoethyl)methyl-
CAS:Formula:C18H16O5Molecular weight:312.3166
