CymitQuimica logo

CAS 88599-20-6

:

Ethanone, 1-(1,2,5,6-tetrahydro-1-methyl-3-pyridinyl)-, hydrobromide

Description:
Ethanone, 1-(1,2,5,6-tetrahydro-1-methyl-3-pyridinyl)-, hydrobromide, commonly referred to as a hydrobromide salt, is a chemical compound characterized by its complex structure that includes a pyridine ring and a ketone functional group. The presence of the tetrahydro-pyridine moiety suggests that it has a cyclic structure, contributing to its potential biological activity. As a hydrobromide, it is typically encountered as a crystalline solid, which enhances its stability and solubility in polar solvents, particularly water. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions are influenced by the functional groups present, which can affect its reactivity and biological activity. The hydrobromide form often improves the compound's bioavailability and facilitates its use in various applications, including research and potential therapeutic uses. Safety data and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or reactivity.
Formula:C8H13NOBrH
InChI:InChI=1S/C8H13NO.BrH/c1-7(10)8-4-3-5-9(2)6-8;/h4H,3,5-6H2,1-2H3;1H
InChI key:GNZWQVQUAXCRTA-UHFFFAOYSA-N
SMILES:CC(=O)C1=CCCN(C1)C.Br
Found 1 products.