CAS 88599-31-9
:2,4-Thiazolidinedione, 5-(2,3-dihydro-1H-inden-5-yl)-
Description:
2,4-Thiazolidinedione, 5-(2,3-dihydro-1H-inden-5-yl)-, identified by CAS number 88599-31-9, is a chemical compound that belongs to the thiazolidinedione class, which is characterized by a five-membered ring containing both sulfur and nitrogen atoms. This compound features a thiazolidinedione core, which is known for its role in pharmacology, particularly in the treatment of diabetes due to its insulin-sensitizing properties. The presence of the 2,3-dihydro-1H-inden-5-yl substituent suggests that it may exhibit unique biological activities or interactions, potentially influencing its pharmacokinetics and pharmacodynamics. Generally, thiazolidinediones are recognized for their ability to modulate glucose metabolism and improve insulin sensitivity, making them valuable in managing type 2 diabetes. The specific structural modifications in this compound may also impart additional properties, such as altered solubility, stability, or receptor affinity. As with many chemical substances, further research is essential to fully elucidate its biological effects and potential therapeutic applications.
Formula:C12H11NO2S
InChI:InChI=1S/C12H11NO2S/c14-11-10(16-12(15)13-11)9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2,(H,13,14,15)
InChI key:CCNSGUDNDJCOLF-UHFFFAOYSA-N
SMILES:C1CC2=C(C1)C=C(C=C2)C3C(=O)NC(=O)S3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,4-Thiazolidinedione, 5-(2,3-dihydro-1H-inden-5-yl)-
CAS:Formula:C12H11NO2SMolecular weight:233.2862
