CymitQuimica logo

CAS 88599-44-4

:

Benzoic acid, 2-[(aminocarbonyl)oxy]-, 2-methylpropyl ester

Description:
Benzoic acid, 2-[(aminocarbonyl)oxy]-, 2-methylpropyl ester, also known by its CAS number 88599-44-4, is an organic compound characterized by its ester functional group derived from benzoic acid and 2-methylpropanol. This compound features a benzoate moiety linked to an aminocarbonyl group, which contributes to its potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the amino and carbonyl groups suggests that it may exhibit properties such as hydrogen bonding, which can influence its solubility and reactivity. This compound may be used in various applications, including pharmaceuticals and agrochemicals, due to its potential as a building block in organic synthesis. Its stability and reactivity can be affected by environmental factors such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c1-8(2)7-16-11(14)9-5-3-4-6-10(9)17-12(13)15/h3-6,8H,7H2,1-2H3,(H2,13,15)
InChI key:KYSPHRKBLFTHAV-UHFFFAOYSA-N
SMILES:CC(C)COC(=O)C1=CC=CC=C1OC(=O)N
Found 1 products.