CAS 88599-56-8
:Benzoic acid, 5-chloro-2-hydroxy-, 2,5-dichlorophenyl ester
Description:
Benzoic acid, 5-chloro-2-hydroxy-, 2,5-dichlorophenyl ester, identified by CAS number 88599-56-8, is an organic compound that belongs to the class of esters. It features a benzoic acid moiety with a hydroxyl group and chlorine substituents, which contribute to its chemical properties. This compound is characterized by its aromatic structure, which enhances its stability and reactivity. The presence of chlorine atoms typically increases the compound's lipophilicity and may influence its biological activity. As an ester, it can undergo hydrolysis in the presence of water, leading to the release of benzoic acid and the corresponding alcohol. This compound may exhibit antimicrobial properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Its solubility in organic solvents and limited solubility in water are typical for such aromatic esters. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.
Formula:C13H7Cl3O3
InChI:InChI=1S/C13H7Cl3O3/c14-7-2-4-11(17)9(5-7)13(18)19-12-6-8(15)1-3-10(12)16/h1-6,17H
InChI key:AUUNODVKNQHFRX-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Cl)C(=O)OC2=C(C=CC(=C2)Cl)Cl)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzoic acid, 5-chloro-2-hydroxy-, 2,5-dichlorophenyl ester
CAS:Formula:C13H7Cl3O3Molecular weight:317.5519
