CymitQuimica logo

CAS 88599-98-8

:

2,4-Pentadienoic acid, 5-(1-hydroxy-2,2,6-trimethylcyclohexyl)-3-methyl-

Description:
2,4-Pentadienoic acid, 5-(1-hydroxy-2,2,6-trimethylcyclohexyl)-3-methyl- is an organic compound characterized by its diene structure, which features two double bonds in its carbon chain. This compound contains a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of the bulky 1-hydroxy-2,2,6-trimethylcyclohexyl group enhances its steric properties, potentially influencing its solubility and interaction with other molecules. The methyl group at the 3-position adds to the complexity of its structure, affecting its physical and chemical properties. Typically, compounds like this may exhibit moderate to high polarity due to the carboxylic acid group, which can engage in hydrogen bonding. Its applications could range from use in organic synthesis to potential roles in materials science, depending on its reactivity and stability. As with many organic compounds, safety and handling precautions are essential, particularly due to the potential for irritation or other health effects associated with exposure.
Formula:C15H24O3
InChI:InChI=1S/C15H24O3/c1-11(10-13(16)17)7-9-15(18)12(2)6-5-8-14(15,3)4/h7,9-10,12,18H,5-6,8H2,1-4H3,(H,16,17)
InChI key:WESUACZGYJGMQZ-UHFFFAOYSA-N
SMILES:CC1CCCC(C1(C=CC(=CC(=O)O)C)O)(C)C
Found 1 products.