CymitQuimica logo

CAS 886-64-6

:

Phenylmethyl N-(3-amino-3-oxopropyl)carbamate

Description:
Phenylmethyl N-(3-amino-3-oxopropyl)carbamate, also known by its CAS number 886-64-6, is a chemical compound that belongs to the class of carbamates. It typically features a phenylmethyl group attached to a carbamate functional group, which is characterized by the presence of a carbonyl (C=O) linked to a nitrogen atom (N). The compound also contains an amino group and a ketone, contributing to its reactivity and potential biological activity. It is often studied for its applications in medicinal chemistry and as a potential pharmaceutical agent due to its structural properties. The presence of the amino and carbonyl functionalities suggests that it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. Additionally, the compound's solubility, stability, and reactivity can be influenced by factors such as pH and temperature. As with many carbamates, it is essential to handle this compound with care, considering its potential toxicity and the need for proper safety measures in laboratory settings.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c12-10(14)6-7-13-11(15)16-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,12,14)(H,13,15)
InChI key:InChIKey=JSVDOBZAAAJMBU-UHFFFAOYSA-N
SMILES:C(OC(NCCC(N)=O)=O)C1=CC=CC=C1
Synonyms:
  • Carbamic acid, (2-carbamoylethyl)-, benzyl ester
  • N-Benzyloxycarbonyl-β-alanine amide
  • Carbamic acid, N-(3-amino-3-oxopropyl)-, phenylmethyl ester
  • Carbamic acid, (3-amino-3-oxopropyl)-, phenylmethyl ester
  • Phenylmethyl N-(3-amino-3-oxopropyl)carbamate
Found 3 products.