CAS 88600-23-1
:9,10-Anthracenedione, 1,4,5,8-tetraamino-2,6-bis[3-(octyloxy)phenoxy]-
Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2,6-bis[3-(octyloxy)phenoxy]- is a complex organic compound characterized by its anthraquinone backbone, which is modified with multiple amino and ether functional groups. This structure contributes to its potential applications in various fields, including organic electronics and materials science. The presence of octyloxy groups enhances its solubility in organic solvents, making it suitable for use in solution-based processes. The amino groups can participate in hydrogen bonding and may influence the compound's reactivity and interaction with other molecules. Additionally, the compound's unique structure may impart interesting optical and electronic properties, which are valuable for applications in dyes, pigments, or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound exemplifies the intricate design often found in organic chemistry, where modifications to a core structure can lead to diverse functional properties.
Formula:C42H52N4O6
InChI:InChI=1S/C42H52N4O6/c1-3-5-7-9-11-13-21-49-27-17-15-19-29(23-27)51-33-25-31(43)35-37(39(33)45)41(47)36-32(44)26-34(40(46)38(36)42(35)48)52-30-20-16-18-28(24-30)50-22-14-12-10-8-6-4-2/h15-20,23-26H,3-14,21-22,43-46H2,1-2H3
InChI key:UFMYQBFCIFKVHL-UHFFFAOYSA-N
SMILES:CCCCCCCCOC1=CC(=CC=C1)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C(=CC(=C4N)OC5=CC=CC(=C5)OCCCCCCCC)N)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4,5,8-Tetraamino-2,6-bis(3-(octyloxy)phenoxy)anthracene-9,10-dione
CAS:Formula:C42H52N4O6Molecular weight:708.8855
