CAS 88600-61-7
:9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(4-fluorophenoxy)-
Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(4-fluorophenoxy)-, with CAS number 88600-61-7, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core substituted with multiple amino and fluorophenoxy groups. This compound typically exhibits properties associated with both its aromatic system and functional groups, such as potential electron-accepting behavior due to the anthracenedione moiety. The presence of amino groups can enhance solubility in polar solvents and may facilitate interactions with biological systems, making it of interest in medicinal chemistry and materials science. The fluorophenoxy substituents may impart unique electronic and steric properties, influencing the compound's reactivity and stability. Additionally, compounds of this nature often display interesting photophysical properties, which can be leveraged in applications such as organic electronics or as dyes. Overall, the specific characteristics of this compound, including its reactivity, solubility, and potential applications, would be influenced by its molecular structure and the arrangement of its substituents.
Formula:C26H18F2N4O4
InChI:InChI=1S/C26H18F2N4O4/c27-11-1-5-13(6-2-11)35-17-9-15(29)19-21(23(17)31)26(34)22-20(25(19)33)16(30)10-18(24(22)32)36-14-7-3-12(28)4-8-14/h1-10H,29-32H2
InChI key:FUDMGDKMEPYJCQ-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C(=C(C=C4N)OC5=CC=C(C=C5)F)N)N)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4,5,8-Tetraamino-2,7-bis(4-fluorophenoxy)anthracene-9,10-dione
CAS:Formula:C26H18F2N4O4Molecular weight:488.4423
