CymitQuimica logo

CAS 88600-62-8

:

9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(3-bromophenoxy)-

Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(3-bromophenoxy)-, with the CAS number 88600-62-8, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core substituted with multiple amino and bromophenoxy groups. This compound typically exhibits properties associated with both its aromatic system and functional groups, such as potential redox activity due to the presence of the anthracenedione moiety. The amino groups can participate in hydrogen bonding and may enhance solubility in polar solvents, while the bromophenoxy substituents can influence the compound's electronic properties and reactivity. The presence of bromine atoms may also impart additional characteristics, such as increased lipophilicity or potential for halogen bonding. Overall, this compound may find applications in fields such as materials science, organic electronics, or medicinal chemistry, particularly in the development of dyes, sensors, or therapeutic agents. However, specific applications and safety profiles would require further investigation and characterization.
Formula:C26H18Br2N4O4
InChI:InChI=1S/C26H18Br2N4O4/c27-11-3-1-5-13(7-11)35-17-9-15(29)19-21(23(17)31)26(34)22-20(25(19)33)16(30)10-18(24(22)32)36-14-6-2-4-12(28)8-14/h1-10H,29-32H2
InChI key:LCBLJUMTHDOYLQ-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)Br)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C(=C(C=C4N)OC5=CC(=CC=C5)Br)N)N
Found 1 products.