CymitQuimica logo

CAS 88600-70-8

:

9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(4-propylphenoxy)-

Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(4-propylphenoxy)-, with the CAS number 88600-70-8, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core substituted with amino and propylphenoxy groups. This compound typically exhibits properties associated with both its anthracene backbone and the functional groups attached to it. The presence of amino groups suggests potential for hydrogen bonding and increased solubility in polar solvents, while the propylphenoxy substituents may enhance hydrophobic interactions and influence its biological activity. The compound may display interesting electronic properties due to the conjugated system of the anthracene moiety, making it potentially useful in applications such as organic electronics, dyes, or as a precursor in organic synthesis. Additionally, its structural features may confer specific reactivity or biological activity, warranting further investigation in fields such as medicinal chemistry or materials science. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C32H32N4O4
InChI:InChI=1S/C32H32N4O4/c1-3-5-17-7-11-19(12-8-17)39-23-15-21(33)25-27(29(23)35)32(38)28-26(31(25)37)22(34)16-24(30(28)36)40-20-13-9-18(6-4-2)10-14-20/h7-16H,3-6,33-36H2,1-2H3
InChI key:LAYXNVADRWSFLI-UHFFFAOYSA-N
SMILES:CCCC1=CC=C(C=C1)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C(=C(C=C4N)OC5=CC=C(C=C5)CCC)N)N
Found 1 products.