CAS 88600-79-7
:9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(2-methoxyphenoxy)-
Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(2-methoxyphenoxy)-, identified by its CAS number 88600-79-7, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core substituted with multiple amino and methoxyphenoxy groups. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential applications in fields such as organic electronics, dyes, and pharmaceuticals. The presence of the anthracenedione moiety suggests that it may possess interesting electronic properties, including the ability to participate in redox reactions. Additionally, the methoxyphenoxy substituents can enhance solubility and modify the compound's reactivity. The tetraamino substitution indicates a high degree of functionalization, which may influence its interaction with biological systems or materials. Overall, this compound's unique structural features may lead to diverse applications, particularly in materials science and medicinal chemistry, although specific properties such as solubility, melting point, and reactivity would require empirical investigation for precise characterization.
Formula:C28H24N4O6
InChI:InChI=1S/C28H24N4O6/c1-35-15-7-3-5-9-17(15)37-19-11-13(29)21-23(25(19)31)28(34)24-22(27(21)33)14(30)12-20(26(24)32)38-18-10-6-4-8-16(18)36-2/h3-12H,29-32H2,1-2H3
InChI key:AWLUCCWKNUBYON-UHFFFAOYSA-N
SMILES:COC1=CC=CC=C1OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C(=C(C=C4N)OC5=CC=CC=C5OC)N)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4,5,8-Tetraamino-2,7-bis(2-methoxyphenoxy)anthracene-9,10-dione
CAS:Formula:C28H24N4O6Molecular weight:512.5134
