CAS 88601-74-5
:9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(3-methoxypropoxy)-
Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2,7-bis(3-methoxypropoxy)-, identified by CAS number 88601-74-5, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core modified with multiple amino and ether functional groups. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential applications in fields such as organic electronics, dyes, and pharmaceuticals. The presence of methoxypropoxy groups enhances its solubility in organic solvents, making it suitable for various formulations. Additionally, the amino groups can participate in hydrogen bonding and other interactions, influencing its reactivity and stability. The compound may also display interesting optical properties due to its conjugated system, which can be leveraged in photonic applications. As with many anthracene derivatives, it is essential to consider its environmental and health impacts, including potential toxicity and biodegradability, when evaluating its use in industrial applications.
Formula:C22H28N4O6
InChI:InChI=1S/C22H28N4O6/c1-29-5-3-7-31-13-9-11(23)15-17(19(13)25)22(28)18-16(21(15)27)12(24)10-14(20(18)26)32-8-4-6-30-2/h9-10H,3-8,23-26H2,1-2H3
InChI key:FXWHQKPTAVWALO-UHFFFAOYSA-N
SMILES:COCCCOC1=C(C2=C(C(=C1)N)C(=O)C3=C(C2=O)C(=C(C=C3N)OCCCOC)N)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4,5,8-Tetraamino-2,7-bis(3-methoxypropoxy)anthracene-9,10-dione
CAS:Formula:C22H28N4O6Molecular weight:444.4809
