CAS 88602-04-4
:9,10-Anthracenedione, 1,4,5,8-tetraamino-2-bromo-6-(3-butylphenoxy)-
Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2-bromo-6-(3-butylphenoxy)-, identified by its CAS number 88602-04-4, is a synthetic organic compound characterized by its complex structure, which includes an anthracene backbone with multiple functional groups. This compound features a dione moiety, which contributes to its potential reactivity and ability to participate in various chemical reactions. The presence of amino groups enhances its solubility in polar solvents and may facilitate interactions with biological systems, making it of interest in medicinal chemistry. The bromine substituent can introduce additional reactivity, while the butylphenoxy group may influence its hydrophobic properties and biological activity. Overall, this compound's unique structural features suggest potential applications in fields such as organic electronics, dye chemistry, or as a precursor in the synthesis of more complex molecules. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C24H23BrN4O3
InChI:InChI=1S/C24H23BrN4O3/c1-2-3-5-11-6-4-7-12(8-11)32-16-10-15(27)18-20(22(16)29)24(31)17-14(26)9-13(25)21(28)19(17)23(18)30/h4,6-10H,2-3,5,26-29H2,1H3
InChI key:FOPQPWKYYFXJJS-UHFFFAOYSA-N
SMILES:CCCCC1=CC(=CC=C1)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C(=CC(=C4N)Br)N)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4,5,8-Tetraamino-2-bromo-6-(3-butylphenoxy)anthracene-9,10-dione
CAS:Formula:C24H23BrN4O3Molecular weight:495.3684
