CymitQuimica logo

CAS 88602-45-3

:

9,10-Anthracenedione, 4-amino-6-chloro-1-hydroxy-2-phenoxy-

Description:
9,10-Anthracenedione, 4-amino-6-chloro-1-hydroxy-2-phenoxy- is a synthetic organic compound characterized by its complex structure, which includes an anthracene backbone with various functional groups. This compound features an amino group, a chloro substituent, a hydroxy group, and a phenoxy moiety, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit a range of colors depending on its specific form and purity. The presence of the anthracenedione structure suggests that it may have applications in organic electronics, dyes, or as a precursor in the synthesis of other chemical entities. Additionally, the functional groups present may impart specific properties such as solubility in organic solvents and potential interactions with biological systems, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with similar compounds. As with any chemical, thorough characterization and understanding of its properties are essential for its application in research or industry.
Formula:C20H12ClNO4
InChI:InChI=1S/C20H12ClNO4/c21-10-6-7-12-13(8-10)19(24)16-14(22)9-15(20(25)17(16)18(12)23)26-11-4-2-1-3-5-11/h1-9,25H,22H2
InChI key:RTNAMOZBNIOLEX-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C=CC(=C4)Cl)O
Found 1 products.