CAS 88602-93-1
:9,10-Anthracenedione, 1,4,5,8-tetraamino-2-bromo-6-methoxy-
Description:
9,10-Anthracenedione, 1,4,5,8-tetraamino-2-bromo-6-methoxy- is a complex organic compound characterized by its anthraquinone backbone, which is a polycyclic aromatic structure. This compound features multiple functional groups, including amino groups, a bromine atom, and a methoxy group, which contribute to its chemical reactivity and potential applications. The presence of the amino groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The bromine atom can serve as a leaving group or participate in further halogenation reactions. The methoxy group can influence the compound's solubility and electronic properties. This substance may exhibit interesting biological activities, making it a candidate for research in fields such as medicinal chemistry or materials science. Its unique structure allows for potential applications in dye synthesis, organic electronics, or as a precursor for more complex molecules. However, specific properties such as solubility, melting point, and reactivity would need to be determined through experimental studies.
Formula:C15H13BrN4O3
InChI:InChI=1S/C15H13BrN4O3/c1-23-7-3-6(18)9-11(13(7)20)15(22)8-5(17)2-4(16)12(19)10(8)14(9)21/h2-3H,17-20H2,1H3
InChI key:BQWZWFPAHZHQMB-UHFFFAOYSA-N
SMILES:COC1=C(C2=C(C(=C1)N)C(=O)C3=C(C2=O)C(=CC(=C3N)Br)N)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4,5,8-Tetraamino-2-bromo-6-methoxyanthracene-9,10-dione
CAS:Formula:C15H13BrN4O3Molecular weight:377.1927
