CymitQuimica logo

CAS 88603-49-0

:

9,10-Anthracenedione, 1,8-diamino-4,5-dihydroxy-2,7-diphenoxy-

Description:
9,10-Anthracenedione, 1,8-diamino-4,5-dihydroxy-2,7-diphenoxy- (CAS 88603-49-0) is a synthetic organic compound characterized by its complex structure, which includes an anthracene backbone with multiple functional groups. This compound features two amino groups, two hydroxyl groups, and two phenoxy groups, contributing to its potential reactivity and solubility properties. The presence of the anthracenedione moiety suggests that it may exhibit interesting electronic properties, making it a candidate for applications in organic electronics or as a dye. The hydroxyl groups can participate in hydrogen bonding, influencing its solubility in polar solvents, while the phenoxy groups may enhance its stability and interaction with other molecules. Additionally, the compound's structure may allow for various chemical modifications, which could be explored for developing new materials or pharmaceuticals. Overall, this compound's unique combination of functional groups and structural features may lead to diverse applications in fields such as materials science and medicinal chemistry.
Formula:C26H18N2O6
InChI:InChI=1S/C26H18N2O6/c27-23-17(33-13-7-3-1-4-8-13)11-15(29)19-21(23)26(32)22-20(25(19)31)16(30)12-18(24(22)28)34-14-9-5-2-6-10-14/h1-12,29-30H,27-28H2
InChI key:RRSWLXMYBJRLTR-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OC2=C(C3=C(C(=C2)O)C(=O)C4=C(C3=O)C(=C(C=C4O)OC5=CC=CC=C5)N)N
Found 1 products.