CAS 88604-00-6
:9,10-Anthracenedione, 1,8-diamino-4,5-dihydroxy-2,7-bis(pentyloxy)-
Description:
9,10-Anthracenedione, 1,8-diamino-4,5-dihydroxy-2,7-bis(pentyloxy)-, with the CAS number 88604-00-6, is a synthetic organic compound characterized by its anthracene backbone, which is a polycyclic aromatic hydrocarbon. This compound features two amino groups and two hydroxyl groups, contributing to its potential reactivity and solubility in various solvents. The presence of pentyloxy groups enhances its hydrophobic properties, which may influence its biological activity and interactions with other molecules. Typically, compounds of this nature are studied for their applications in organic electronics, dyes, and as potential therapeutic agents due to their ability to interact with biological systems. The structural features suggest that it may exhibit interesting photophysical properties, making it a candidate for research in fields such as materials science and medicinal chemistry. However, specific data regarding its toxicity, stability, and environmental impact would require further investigation and analysis.
Formula:C24H30N2O6
InChI:InChI=1S/C24H30N2O6/c1-3-5-7-9-31-15-11-13(27)17-19(21(15)25)24(30)20-18(23(17)29)14(28)12-16(22(20)26)32-10-8-6-4-2/h11-12,27-28H,3-10,25-26H2,1-2H3
InChI key:ZTPZCORCIQIKMU-UHFFFAOYSA-N
SMILES:CCCCCOC1=C(C2=C(C(=C1)O)C(=O)C3=C(C2=O)C(=C(C=C3O)OCCCCC)N)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,8-Diamino-4,5-dihydroxy-2,7-bis(pentyloxy)anthracene-9,10-dione
CAS:Formula:C24H30N2O6Molecular weight:442.5048
