CymitQuimica logo

CAS 88605-06-5

:

9,10-Anthracenedione, 1-amino-7-chloro-4-hydroxy-2-propoxy-

Description:
9,10-Anthracenedione, 1-amino-7-chloro-4-hydroxy-2-propoxy- is a chemical compound that belongs to the class of anthraquinones, which are characterized by their polycyclic aromatic structure and the presence of two carbonyl groups. This specific compound features an amino group, a chloro substituent, and a hydroxy group, contributing to its potential reactivity and biological activity. The propoxy group enhances its solubility in organic solvents, which can influence its application in various fields, including pharmaceuticals and dyes. The presence of the amino and hydroxy groups suggests that it may participate in hydrogen bonding, affecting its interactions with other molecules. Additionally, the chloro substituent can impart unique electronic properties, potentially influencing its behavior in chemical reactions. Overall, this compound's structure suggests it may exhibit interesting properties, making it a subject of interest for further research in medicinal chemistry and material science.
Formula:C17H14ClNO4
InChI:InChI=1S/C17H14ClNO4/c1-2-5-23-12-7-11(20)13-14(15(12)19)17(22)10-6-8(18)3-4-9(10)16(13)21/h3-4,6-7,20H,2,5,19H2,1H3
InChI key:HDXNFGCJFMDUBE-UHFFFAOYSA-N
SMILES:CCCOC1=C(C2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3)Cl)N
Found 1 products.