CymitQuimica logo

CAS 88605-16-7

:

9,10-Anthracenedione, 4-amino-6-chloro-1-hydroxy-2-(2-phenylethoxy)-

Description:
9,10-Anthracenedione, 4-amino-6-chloro-1-hydroxy-2-(2-phenylethoxy)-, identified by CAS number 88605-16-7, is a synthetic organic compound that belongs to the anthraquinone class. This compound features a polycyclic aromatic structure, characterized by its anthracene backbone, which is substituted at specific positions with functional groups including an amino group, a chloro group, and a phenylethoxy moiety. The presence of the hydroxyl group contributes to its potential reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its unique structure allows for various interactions with biological targets, which could lead to applications in medicinal chemistry. Additionally, the chlorinated and phenyl-substituted groups may influence its electronic properties and stability. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C22H16ClNO4
InChI:InChI=1S/C22H16ClNO4/c23-13-6-7-14-15(10-13)21(26)18-16(24)11-17(22(27)19(18)20(14)25)28-9-8-12-4-2-1-3-5-12/h1-7,10-11,27H,8-9,24H2
InChI key:UZBKVEMKHHSCKM-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CCOC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C=CC(=C4)Cl)O
Found 1 products.