CymitQuimica logo

CAS 88605-18-9

:

9,10-Anthracenedione, 1,4-diamino-6-chloro-2-(2-chlorophenoxy)-

Description:
9,10-Anthracenedione, 1,4-diamino-6-chloro-2-(2-chlorophenoxy)-, with the CAS number 88605-18-9, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core modified with amino and chloro substituents. This compound typically exhibits properties associated with both anthraquinone derivatives and amine functionalities, such as potential redox activity and the ability to form hydrogen bonds. It may display moderate solubility in organic solvents, depending on the specific substituents and their interactions. The presence of chlorine atoms can influence its reactivity and stability, potentially enhancing its biological activity or toxicity. Compounds of this nature are often investigated for their applications in pharmaceuticals, dyes, or as intermediates in organic synthesis. Safety data should be reviewed, as halogenated compounds can pose environmental and health risks. Overall, the unique combination of functional groups in this compound suggests a diverse range of potential applications and biological interactions.
Formula:C20H12Cl2N2O3
InChI:InChI=1S/C20H12Cl2N2O3/c21-9-5-6-10-11(7-9)20(26)16-13(23)8-15(18(24)17(16)19(10)25)27-14-4-2-1-3-12(14)22/h1-8H,23-24H2
InChI key:HSEOKPFBDBBAGL-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C=CC(=C4)Cl)N)Cl
Found 1 products.