CymitQuimica logo

CAS 88605-21-4

:

9,10-Anthracenedione, 1,4-diamino-6-chloro-2-(3-methylphenoxy)-

Description:
9,10-Anthracenedione, 1,4-diamino-6-chloro-2-(3-methylphenoxy)-, with the CAS number 88605-21-4, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core modified with amino and chloro functional groups, as well as a phenoxy substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential fluorescence and redox activity due to the presence of the anthracenedione moiety. It may also demonstrate solubility in organic solvents, depending on the specific substituents and their interactions. The presence of amino and chloro groups can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this nature may have applications in fields such as materials science, pharmaceuticals, or dye chemistry, owing to their unique electronic properties and structural characteristics. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C21H15ClN2O3
InChI:InChI=1S/C21H15ClN2O3/c1-10-3-2-4-12(7-10)27-16-9-15(23)17-18(19(16)24)20(25)13-6-5-11(22)8-14(13)21(17)26/h2-9H,23-24H2,1H3
InChI key:LFACQUFPEUYXMH-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C=CC(=C4)Cl)N
Found 1 products.