CymitQuimica logo

CAS 88605-29-2

:

9,10-Anthracenedione, 1,4-diamino-7-chloro-2-(4-chlorophenoxy)-

Description:
9,10-Anthracenedione, 1,4-diamino-7-chloro-2-(4-chlorophenoxy)-, identified by CAS number 88605-29-2, is a synthetic organic compound characterized by its complex structure, which includes an anthracenedione core substituted with amino and chloro groups. This compound typically exhibits properties associated with both aromatic compounds and quinones, such as potential redox activity and the ability to participate in electron transfer processes. Its chlorinated phenoxy group may enhance its lipophilicity, influencing its solubility and biological activity. The presence of amino groups suggests potential for hydrogen bonding and reactivity, making it of interest in various chemical and pharmaceutical applications. Additionally, compounds of this nature may exhibit photochemical properties, making them relevant in fields such as dye chemistry or as intermediates in organic synthesis. Safety and handling considerations are important, as with many chlorinated and nitrogen-containing compounds, due to potential toxicity and environmental impact.
Formula:C20H12Cl2N2O3
InChI:InChI=1S/C20H12Cl2N2O3/c21-9-1-4-11(5-2-9)27-15-8-14(23)16-17(18(15)24)20(26)13-7-10(22)3-6-12(13)19(16)25/h1-8H,23-24H2
InChI key:HCWOEEPQBPWLJO-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C=C(C=C4)Cl)N)Cl
Found 1 products.