CAS 88605-47-4
:9,10-Anthracenedione, 1,4-diamino-7-chloro-2-propoxy-
Description:
9,10-Anthracenedione, 1,4-diamino-7-chloro-2-propoxy- is a synthetic organic compound that belongs to the class of anthraquinones, which are known for their vibrant colors and applications in dyes and pigments. This compound features a fused three-ring structure characteristic of anthracene, with two carbonyl groups (ketones) at the 9 and 10 positions, contributing to its reactivity and potential biological activity. The presence of amino groups at the 1 and 4 positions enhances its solubility and reactivity, while the chloro and propoxy substituents introduce additional functional diversity. This compound may exhibit properties such as fluorescence and redox activity, making it of interest in various fields, including materials science and medicinal chemistry. Its specific applications can vary, but it may be explored for use in pharmaceuticals or as a dye. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C17H15ClN2O3
InChI:InChI=1S/C17H15ClN2O3/c1-2-5-23-12-7-11(19)13-14(15(12)20)17(22)10-6-8(18)3-4-9(10)16(13)21/h3-4,6-7H,2,5,19-20H2,1H3
InChI key:LQPQODBIJVXBLO-UHFFFAOYSA-N
SMILES:CCCOC1=C(C2=C(C(=C1)N)C(=O)C3=C(C2=O)C=C(C=C3)Cl)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4-Diamino-7-chloro-2-propoxyanthracene-9,10-dione
CAS:Formula:C17H15ClN2O3Molecular weight:330.7656
