CymitQuimica logo

CAS 88605-48-5

:

9,10-Anthracenedione, 1,4-diamino-2-butoxy-7-chloro-

Description:
9,10-Anthracenedione, 1,4-diamino-2-butoxy-7-chloro- is a synthetic organic compound characterized by its complex structure, which includes an anthracene backbone with functional groups that enhance its reactivity and solubility. This compound typically exhibits a deep color, often associated with its anthraquinone derivatives, and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of amino and chloro groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the butoxy group contributes to its solubility in organic solvents, making it suitable for diverse applications. Its unique properties may also impart biological activity, which could be of interest in medicinal chemistry. However, safety and handling precautions are essential due to the potential toxicity associated with similar compounds. Overall, 9,10-Anthracenedione, 1,4-diamino-2-butoxy-7-chloro- represents a versatile structure with significant implications in chemical research and application.
Formula:C18H17ClN2O3
InChI:InChI=1S/C18H17ClN2O3/c1-2-3-6-24-13-8-12(20)14-15(16(13)21)18(23)11-7-9(19)4-5-10(11)17(14)22/h4-5,7-8H,2-3,6,20-21H2,1H3
InChI key:PXPVCAGAISZLQW-UHFFFAOYSA-N
SMILES:CCCCOC1=C(C2=C(C(=C1)N)C(=O)C3=C(C2=O)C=C(C=C3)Cl)N
Found 1 products.