CymitQuimica logo

CAS 88607-11-8

:

1,1'-Biphenyl, 3-fluoro-4-methoxy-4'-pentyl-

Description:
1,1'-Biphenyl, 3-fluoro-4-methoxy-4'-pentyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 3-position and a methoxy group (-OCH3) at the 4-position on one phenyl ring, along with a pentyl chain (-C5H11) at the 4'-position of the other ring, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the methoxy group, while the pentyl chain increases its hydrophobic character. The fluorine substitution can enhance the compound's stability and influence its reactivity, potentially affecting its interactions in various chemical environments. Additionally, the presence of multiple functional groups suggests that it may participate in a range of chemical reactions, making it of interest in fields such as materials science and organic synthesis. Its CAS number, 88607-11-8, allows for easy identification and reference in chemical databases.
Formula:C18H21FO
InChI:InChI=1S/C18H21FO/c1-3-4-5-6-14-7-9-15(10-8-14)16-11-12-18(20-2)17(19)13-16/h7-13H,3-6H2,1-2H3
InChI key:HFJDZNIMBVCBLT-UHFFFAOYSA-N
SMILES:CCCCCC1=CC=C(C=C1)C2=CC(=C(C=C2)OC)F
Found 1 products.