CymitQuimica logo

CAS 88607-53-8

:

Ethanone, 1-[1-[2-(2-ethyl-1H-indol-3-yl)ethyl]-3-piperidinyl]-

Description:
Ethanone, 1-[1-[2-(2-ethyl-1H-indol-3-yl)ethyl]-3-piperidinyl]- is a chemical compound characterized by its complex structure, which includes an ethanone moiety and a piperidine ring. This compound features an indole derivative, specifically a 2-ethyl-1H-indole, which contributes to its unique properties and potential biological activity. The presence of the piperidine ring suggests that it may exhibit basic properties, as piperidines are typically basic due to the nitrogen atom in the ring. The compound's structure indicates potential interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Its CAS number, 88607-53-8, allows for easy identification in chemical databases. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature often exhibit moderate to high lipophilicity, which can influence their bioavailability and pharmacokinetics. Overall, this compound's unique structural features suggest potential applications in drug development and research.
Formula:C19H26N2O
InChI:InChI=1S/C19H26N2O/c1-3-18-17(16-8-4-5-9-19(16)20-18)10-12-21-11-6-7-15(13-21)14(2)22/h4-5,8-9,15,20H,3,6-7,10-13H2,1-2H3
InChI key:STVWAYDBYXANBI-UHFFFAOYSA-N
SMILES:CCC1=C(C2=CC=CC=C2N1)CCN3CCCC(C3)C(=O)C
Found 1 products.