CAS 88608-85-9
:Benzene, bis[(chloronitrophenyl)methyl]methylnitro-
Description:
Benzene, bis[(chloronitrophenyl)methyl]methylnitro-, with the CAS number 88608-85-9, is a synthetic organic compound characterized by its complex structure, which includes a benzene ring substituted with multiple functional groups. This compound features chloronitrophenyl groups, indicating the presence of both chlorine and nitro substituents on the phenyl rings, which can significantly influence its chemical reactivity and physical properties. Typically, compounds of this nature exhibit high stability due to the resonance stabilization provided by the aromatic system. However, the presence of electron-withdrawing groups like nitro and chlorine can enhance their reactivity, particularly in electrophilic substitution reactions. The compound may also display notable solubility characteristics, often being soluble in organic solvents while exhibiting limited solubility in water. Additionally, due to the presence of nitro groups, it may possess potential applications in fields such as materials science or as intermediates in organic synthesis, though safety and environmental considerations are paramount due to the toxicity associated with nitroaromatic compounds.
Formula:C21H15Cl2N3O6
InChI:InChI=1S/C21H15Cl2N3O6/c1-12-16(11-15-5-3-7-18(23)21(15)26(31)32)13(8-9-19(12)24(27)28)10-14-4-2-6-17(22)20(14)25(29)30/h2-9H,10-11H2,1H3
InChI key:GPJHSQDDYNCOBS-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1CC2=C(C(=CC=C2)Cl)[N+](=O)[O-])CC3=C(C(=CC=C3)Cl)[N+](=O)[O-])[N+](=O)[O-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzene, bis[(chloronitrophenyl)methyl]methylnitro-
CAS:Formula:C21H15Cl2N3O6Molecular weight:476.2663
